![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| %3fC%3dM;O%3dA/ | 2024-09-21 17:28 | - | |
| %3fC%3dN;O%3dD/ | 2024-09-21 17:28 | - | |
| %3fC%3dS;O%3dA/ | 2024-09-21 17:28 | - | |
| Biological Chemistry/ | 2024-09-21 17:28 | - | |
| Biophysics and Medical Devices1/ | 2024-09-21 17:28 | - | |
| Clinical Pharmacology with Prescription/ | 2024-09-21 17:28 | - | |
| Current Topics in Nursing/ | 2024-09-21 17:28 | - | |
| European Culture/ | 2024-09-21 17:28 | - | |
| Heath Assessment/ | 2024-09-21 17:28 | - | |
| History of Ukraine/ | 2024-09-21 17:28 | - | |
| Lidership in nursing/ | 2024-09-21 17:28 | - | |
| Medical Biology, Parasitology and Genetics/ | 2024-09-21 17:28 | - | |
| Medical Informatics/ | 2024-09-21 17:28 | - | |
| Medical Statistics/ | 2024-09-21 17:28 | - | |
| Nursing Research/ | 2024-09-21 17:28 | - | |
| Pathological Anatomy/ | 2024-09-21 17:28 | - | |
| Pathological Physiology/ | 2024-09-21 17:28 | - | |
| Philosophy/ | 2024-09-21 17:28 | - | |
| Ukrainian language/ | 2024-09-21 17:28 | - | |